C16H14F3NO2S — CID 59485705
1-(4-methylphenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]aziridine (PubChem CID 59485705) has the molecular formula C16H14F3NO2S and a molecular weight of 341.35 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]aziridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]aziridine |
|---|---|
| PubChem CID | 59485705 |
| Molecular Formula | C16H14F3NO2S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2-[3-(trifluoromethyl)phenyl]aziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC2c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H14F3NO2S/c1-11-5-7-14(8-6-11)23(21,22)20-10-15(20)12-3-2-4-13(9-12)16(17,18)19/h2-9,15H,10H2,1H3 |
| InChIKey | CNVNLSMQKUZKCL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|