C12H14F3NO3S — CID 128963640
1-methylsulfonyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol (PubChem CID 128963640) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is 1-methylsulfonyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
| Compound Name | 1-methylsulfonyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 128963640 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1-methylsulfonyl-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| SMILES | CS(=O)(=O)N1CC(O)CC1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-20(18,19)16-7-10(17)6-11(16)8-3-2-4-9(5-8)12(13,14)15/h2-5,10-11,17H,6-7H2,1H3 |
| InChIKey | RSUNVCSPQZSABF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |