C12H14F3NO2S2 — CID 124617909
(3R)-4-methylsulfonyl-3-[3-(trifluoromethyl)phenyl]thiomorpholine (PubChem CID 124617909) has the molecular formula C12H14F3NO2S2 and a molecular weight of 325.38 g/mol. Its IUPAC name is (3R)-4-methylsulfonyl-3-[3-(trifluoromethyl)phenyl]thiomorpholine.
| Compound Name | (3R)-4-methylsulfonyl-3-[3-(trifluoromethyl)phenyl]thiomorpholine |
|---|---|
| PubChem CID | 124617909 |
| Molecular Formula | C12H14F3NO2S2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (3R)-4-methylsulfonyl-3-[3-(trifluoromethyl)phenyl]thiomorpholine |
| SMILES | CS(=O)(=O)N1CCSC[C@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO2S2/c1-20(17,18)16-5-6-19-8-11(16)9-3-2-4-10(7-9)12(13,14)15/h2-4,7,11H,5-6,8H2,1H3/t11-/m0/s1 |
| InChIKey | YQQFFMOKDDKSKS-NSHDSACASA-N |
| XLogP | 2.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |