C14H19F3N2S — CID 106444508
1-(4-methylthiomorpholin-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 106444508) has the molecular formula C14H19F3N2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 1-(4-methylthiomorpholin-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 1-(4-methylthiomorpholin-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 106444508 |
| Molecular Formula | C14H19F3N2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(4-methylthiomorpholin-3-yl)-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CN1CCSCC1C(N)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2S/c1-19-5-6-20-9-13(19)12(18)8-10-3-2-4-11(7-10)14(15,16)17/h2-4,7,12-13H,5-6,8-9,18H2,1H3 |
| InChIKey | WBNAGKZYTZTFAH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |