About (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide
(2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide (PubChem CID 102330847) has the molecular formula C16H24N2O3S
and a molecular weight of 324.45 g/mol. Its IUPAC name is (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide.
Molecular Properties
| Compound Name | (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide |
| PubChem CID | 102330847 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C(C)(C)C)[C@@H]2C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-11-7-9-12(10-8-11)22(20,21)18-13(15(19)17(5)6)14(18)16(2,3)4/h7-10,13-14H,1-6H3/t13-,14+,18?/m1/s1 |
| InChIKey | AIMYKMLATOFCCU-RMAOKOMNSA-N |
| XLogP | 1.87 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide?
The IUPAC name of (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide (CID 102330847) is (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide.
What is the SMILES notation for (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide?
The canonical SMILES for (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide is Cc1ccc(S(=O)(=O)N2[C@H](C(C)(C)C)[C@@H]2C(=O)N(C)C)cc1.
What is the InChIKey of (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide?
The InChIKey is AIMYKMLATOFCCU-RMAOKOMNSA-N. The full InChI is InChI=1S/C16H24N2O3S/c1-11-7-9-12(10-8-11)22(20,21)18-13(15(19)17(5)6)14(18)16(2,3)4/h7-10,13-14H,1-6H3/t13-,14+,18?/m1/s1.
What are the key properties of (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide?
(2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide has a molecular weight of 324.45 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide is sourced from PubChem (CID 102330847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).