C16H24N2O3S — CID 102330847
(2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide (PubChem CID 102330847) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide.
| Compound Name | (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 102330847 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R,3R)-3-tert-butyl-N,N-dimethyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C(C)(C)C)[C@@H]2C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-11-7-9-12(10-8-11)22(20,21)18-13(15(19)17(5)6)14(18)16(2,3)4/h7-10,13-14H,1-6H3/t13-,14+,18?/m1/s1 |
| InChIKey | AIMYKMLATOFCCU-RMAOKOMNSA-N |
| XLogP | 1.87 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|