C20H23NO3S — CID 10066920
2,2-dimethyl-1-[(2S,3R)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]propan-1-one (PubChem CID 10066920) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2S,3R)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[(2S,3R)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 10066920 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2,2-dimethyl-1-[(2S,3R)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]propan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C(=O)C(C)(C)C)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO3S/c1-14-10-12-16(13-11-14)25(23,24)21-17(15-8-6-5-7-9-15)18(21)19(22)20(2,3)4/h5-13,17-18H,1-4H3/t17-,18+,21?/m1/s1 |
| InChIKey | UQUWULLUXVIMOX-IZKAZRHKSA-N |
| XLogP | 3.72 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|