C22H21NO3S — CID 102373671
(R)-[(2S,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]-phenylmethanol (PubChem CID 102373671) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is (R)-[(2S,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2S,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 102373671 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (R)-[(2S,3S)-1-(4-methylphenyl)sulfonyl-3-phenylaziridin-2-yl]-phenylmethanol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]([C@H](O)c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-16-12-14-19(15-13-16)27(25,26)23-20(17-8-4-2-5-9-17)21(23)22(24)18-10-6-3-7-11-18/h2-15,20-22,24H,1H3/t20-,21-,22+,23?/m0/s1 |
| InChIKey | SFYFPQQRYLYMBL-JYEDNEFCSA-N |
| XLogP | 3.84 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|