C20H27NO3SSi — CID 102373675
(R)-phenyl-[(2S,3S)-3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridin-2-yl]methanol (PubChem CID 102373675) has the molecular formula C20H27NO3SSi and a molecular weight of 389.59 g/mol. Its IUPAC name is (R)-phenyl-[(2S,3S)-3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridin-2-yl]methanol.
| Compound Name | (R)-phenyl-[(2S,3S)-3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridin-2-yl]methanol |
|---|---|
| PubChem CID | 102373675 |
| Molecular Formula | C20H27NO3SSi |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (R)-phenyl-[(2S,3S)-3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridin-2-yl]methanol |
| SMILES | C[Si](C)(C)CCS(=O)(=O)N1[C@H]([C@H](O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H27NO3SSi/c1-26(2,3)15-14-25(23,24)21-18(16-10-6-4-7-11-16)19(21)20(22)17-12-8-5-9-13-17/h4-13,18-20,22H,14-15H2,1-3H3/t18-,19-,20+,21?/m0/s1 |
| InChIKey | LUYWUKNDQDLEHA-CBQMWWCCSA-N |
| XLogP | 3.81 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|