C16H25NO — CID 139039673
(1S)-1-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-2-methylpropan-1-ol (PubChem CID 139039673) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (1S)-1-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-2-methylpropan-1-ol.
| Compound Name | (1S)-1-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 139039673 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (1S)-1-[(2R,3R)-1-tert-butyl-3-phenylaziridin-2-yl]-2-methylpropan-1-ol |
| SMILES | CC(C)[C@H](O)[C@H]1[C@@H](c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C16H25NO/c1-11(2)15(18)14-13(17(14)16(3,4)5)12-9-7-6-8-10-12/h6-11,13-15,18H,1-5H3/t13-,14-,15+,17?/m1/s1 |
| InChIKey | FMEDQMVXNWWCIJ-TUCDSHDJSA-N |
| XLogP | 3.23 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|