C22H28NO3P — CID 139063841
(3R)-3-[(2S,4R,5S)-3-tert-butyl-2-oxo-4,5-diphenyl-1,3,2λ5-oxazaphospholidin-2-yl]butan-2-one (PubChem CID 139063841) has the molecular formula C22H28NO3P and a molecular weight of 385.44 g/mol. Its IUPAC name is (3R)-3-[(2S,4R,5S)-3-tert-butyl-2-oxo-4,5-diphenyl-1,3,2λ5-oxazaphospholidin-2-yl]butan-2-one.
| Compound Name | (3R)-3-[(2S,4R,5S)-3-tert-butyl-2-oxo-4,5-diphenyl-1,3,2λ5-oxazaphospholidin-2-yl]butan-2-one |
|---|---|
| PubChem CID | 139063841 |
| Molecular Formula | C22H28NO3P |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (3R)-3-[(2S,4R,5S)-3-tert-butyl-2-oxo-4,5-diphenyl-1,3,2λ5-oxazaphospholidin-2-yl]butan-2-one |
| SMILES | CC(=O)[C@@H](C)[P@]1(=O)O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C22H28NO3P/c1-16(24)17(2)27(25)23(22(3,4)5)20(18-12-8-6-9-13-18)21(26-27)19-14-10-7-11-15-19/h6-15,17,20-21H,1-5H3/t17-,20-,21+,27+/m1/s1 |
| InChIKey | ITSNVOCMHGSSNZ-SCYNSUNISA-N |
| XLogP | 5.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|