C24H28NOP — CID 11025239
(1R,3S,3aR,7aR)-2-tert-butyl-7a-methyl-1,3-diphenyl-3,3a-dihydro-2,1lambda5-benzazaphosphole 1-oxide (PubChem CID 11025239) has the molecular formula C24H28NOP and a molecular weight of 377.47 g/mol. Its IUPAC name is (1R,3S,3aR,7aR)-2-tert-butyl-7a-methyl-1,3-diphenyl-3,3a-dihydro-2,1lambda5-benzazaphosphole 1-oxide.
| Compound Name | (1R,3S,3aR,7aR)-2-tert-butyl-7a-methyl-1,3-diphenyl-3,3a-dihydro-2,1lambda5-benzazaphosphole 1-oxide |
|---|---|
| PubChem CID | 11025239 |
| Molecular Formula | C24H28NOP |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (1R,3S,3aR,7aR)-2-tert-butyl-7a-methyl-1,3-diphenyl-3,3a-dihydro-2,1lambda5-benzazaphosphole 1-oxide |
| SMILES | CC(C)(C)N1[C@H](c2ccccc2)[C@H]2C=CC=C[C@@]2(C)[P@]1(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28NOP/c1-23(2,3)25-22(19-13-7-5-8-14-19)21-17-11-12-18-24(21,4)27(25,26)20-15-9-6-10-16-20/h5-18,21-22H,1-4H3/t21-,22-,24-,27-/m1/s1 |
| InChIKey | PEKHWKCKDLGYOW-SPEYYTFGSA-N |
| XLogP | 5.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|