C21H29N2OP — CID 135033737
(4S,5S)-2-methyl-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2λ5-diazaphospholidine 2-oxide (PubChem CID 135033737) has the molecular formula C21H29N2OP and a molecular weight of 356.45 g/mol. Its IUPAC name is (4S,5S)-2-methyl-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2λ5-diazaphospholidine 2-oxide.
| Compound Name | (4S,5S)-2-methyl-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2λ5-diazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 135033737 |
| Molecular Formula | C21H29N2OP |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (4S,5S)-2-methyl-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2λ5-diazaphospholidine 2-oxide |
| SMILES | CC(C)N1[C@@H](c2ccccc2)[C@H](c2ccccc2)N(C(C)C)P1(C)=O |
| InChI | InChI=1S/C21H29N2OP/c1-16(2)22-20(18-12-8-6-9-13-18)21(19-14-10-7-11-15-19)23(17(3)4)25(22,5)24/h6-17,20-21H,1-5H3/t20-,21-/m0/s1 |
| InChIKey | KRNKKSNMCAEOJI-SFTDATJTSA-N |
| XLogP | 5.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|