C27H32N3OP — CID 177413293
(E)-N-[(4S,5S)-2-oxido-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylmethanimine (PubChem CID 177413293) has the molecular formula C27H32N3OP and a molecular weight of 445.55 g/mol. Its IUPAC name is (E)-N-[(4S,5S)-2-oxido-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylmethanimine.
| Compound Name | (E)-N-[(4S,5S)-2-oxido-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 177413293 |
| Molecular Formula | C27H32N3OP |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (E)-N-[(4S,5S)-2-oxido-4,5-diphenyl-1,3-di(propan-2-yl)-1,3,2-diazaphospholidin-2-ium-2-yl]-1-phenylmethanimine |
| SMILES | CC(C)N1[C@@H](c2ccccc2)[C@H](c2ccccc2)N(C(C)C)[P+]1([O-])/N=C/c1ccccc1 |
| InChI | InChI=1S/C27H32N3OP/c1-21(2)29-26(24-16-10-6-11-17-24)27(25-18-12-7-13-19-25)30(22(3)4)32(29,31)28-20-23-14-8-5-9-15-23/h5-22,26-27H,1-4H3/b28-20+/t26-,27-/m0/s1 |
| InChIKey | ZRUUBEARZMVFMN-NKOMCJRBSA-N |
| XLogP | 6.06 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|