C19H29FN3OP — CID 177470327
(E)-N-[(3aS,7aS)-2-oxido-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2-fluorophenyl)methanimine (PubChem CID 177470327) has the molecular formula C19H29FN3OP and a molecular weight of 365.43 g/mol. Its IUPAC name is (E)-N-[(3aS,7aS)-2-oxido-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2-fluorophenyl)methanimine.
| Compound Name | (E)-N-[(3aS,7aS)-2-oxido-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 177470327 |
| Molecular Formula | C19H29FN3OP |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (E)-N-[(3aS,7aS)-2-oxido-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2-fluorophenyl)methanimine |
| SMILES | CC(C)N1[C@H]2CCCC[C@@H]2N(C(C)C)[P+]1([O-])/N=C/c1ccccc1F |
| InChI | InChI=1S/C19H29FN3OP/c1-14(2)22-18-11-7-8-12-19(18)23(15(3)4)25(22,24)21-13-16-9-5-6-10-17(16)20/h5-6,9-10,13-15,18-19H,7-8,11-12H2,1-4H3/b21-13+/t18-,19-/m0/s1 |
| InChIKey | QUTQFCAKNOXHOW-GCOJUMRASA-N |
| XLogP | 4.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|