C23H32N3OP — CID 177412797
(E)-N-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-naphthalen-1-ylmethanimine (PubChem CID 177412797) has the molecular formula C23H32N3OP and a molecular weight of 397.50 g/mol. Its IUPAC name is (E)-N-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-naphthalen-1-ylmethanimine.
| Compound Name | (E)-N-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-naphthalen-1-ylmethanimine |
|---|---|
| PubChem CID | 177412797 |
| Molecular Formula | C23H32N3OP |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (E)-N-[(3aR,7aR)-2-oxo-1,3-di(propan-2-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-naphthalen-1-ylmethanimine |
| SMILES | CC(C)N1[C@@H]2CCCC[C@H]2N(C(C)C)P1(=O)/N=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C23H32N3OP/c1-17(2)25-22-14-7-8-15-23(22)26(18(3)4)28(25,27)24-16-20-12-9-11-19-10-5-6-13-21(19)20/h5-6,9-13,16-18,22-23H,7-8,14-15H2,1-4H3/b24-16+/t22-,23-/m1/s1 |
| InChIKey | DAPNKMJPFFGWQJ-KEBYFXCJSA-N |
| XLogP | 6.11 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|