C36H36N3OP — CID 25241768
(E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-(2-methylphenyl)methanimine (PubChem CID 25241768) has the molecular formula C36H36N3OP and a molecular weight of 557.68 g/mol. Its IUPAC name is (E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-(2-methylphenyl)methanimine.
| Compound Name | (E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 25241768 |
| Molecular Formula | C36H36N3OP |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-yl]-1-(2-methylphenyl)methanimine |
| SMILES | Cc1ccccc1/C=N/P1(=O)N(Cc2cccc3ccccc23)[C@@H]2CCCC[C@H]2N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C36H36N3OP/c1-27-12-2-3-15-30(27)24-37-41(40)38(25-31-18-10-16-28-13-4-6-20-33(28)31)35-22-8-9-23-36(35)39(41)26-32-19-11-17-29-14-5-7-21-34(29)32/h2-7,10-21,24,35-36H,8-9,22-23,25-26H2,1H3/b37-24+/t35-,36-/m1/s1 |
| InChIKey | FDRGSNCZUFRQSX-CUJZTYFPSA-N |
| XLogP | 9.16 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|