C39H42N3OPS2 — CID 53242437
(3aR,7aR)-N-[(R)-1,3-dithian-2-yl(phenyl)methyl]-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-amine (PubChem CID 53242437) has the molecular formula C39H42N3OPS2 and a molecular weight of 663.89 g/mol. Its IUPAC name is (3aR,7aR)-N-[(R)-1,3-dithian-2-yl(phenyl)methyl]-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-amine.
| Compound Name | (3aR,7aR)-N-[(R)-1,3-dithian-2-yl(phenyl)methyl]-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-amine |
|---|---|
| PubChem CID | 53242437 |
| Molecular Formula | C39H42N3OPS2 |
| Molecular Weight | 663.89 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | (3aR,7aR)-N-[(R)-1,3-dithian-2-yl(phenyl)methyl]-1,3-bis(naphthalen-1-ylmethyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-amine |
| SMILES | O=P1(N[C@H](c2ccccc2)C2SCCCS2)N(Cc2cccc3ccccc23)[C@@H]2CCCC[C@H]2N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C39H42N3OPS2/c43-44(40-38(31-15-2-1-3-16-31)39-45-25-12-26-46-39)41(27-32-19-10-17-29-13-4-6-21-34(29)32)36-23-8-9-24-37(36)42(44)28-33-20-11-18-30-14-5-7-22-35(30)33/h1-7,10-11,13-22,36-39H,8-9,12,23-28H2,(H,40,43)/t36-,37-,38-/m1/s1 |
| InChIKey | UGRABESSJDRDTR-UJTUJTOWSA-N |
| XLogP | 10.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.89 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|