C37H38N3OP — CID 177446765
(E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2,6-dimethylphenyl)methanimine (PubChem CID 177446765) has the molecular formula C37H38N3OP and a molecular weight of 571.71 g/mol. Its IUPAC name is (E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2,6-dimethylphenyl)methanimine.
| Compound Name | (E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2,6-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 177446765 |
| Molecular Formula | C37H38N3OP |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | (E)-N-[(3aR,7aR)-1,3-bis(naphthalen-1-ylmethyl)-2-oxido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]diazaphosphol-2-ium-2-yl]-1-(2,6-dimethylphenyl)methanimine |
| SMILES | Cc1cccc(C)c1/C=N/[P+]1([O-])N(Cc2cccc3ccccc23)[C@@H]2CCCC[C@H]2N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C37H38N3OP/c1-27-12-9-13-28(2)35(27)24-38-42(41)39(25-31-18-10-16-29-14-3-5-20-33(29)31)36-22-7-8-23-37(36)40(42)26-32-19-11-17-30-15-4-6-21-34(30)32/h3-6,9-21,24,36-37H,7-8,22-23,25-26H2,1-2H3/b38-24+/t36-,37-/m1/s1 |
| InChIKey | IPYOIIYCWQQBDD-AWBRHZSPSA-N |
| XLogP | 8.40 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|