C29H29NO — CID 101464213
(2S)-4-methyl-2-(naphthalen-1-ylmethylideneamino)-1,1-diphenylpentan-1-ol (PubChem CID 101464213) has the molecular formula C29H29NO and a molecular weight of 407.56 g/mol. Its IUPAC name is (2S)-4-methyl-2-(naphthalen-1-ylmethylideneamino)-1,1-diphenylpentan-1-ol.
| Compound Name | (2S)-4-methyl-2-(naphthalen-1-ylmethylideneamino)-1,1-diphenylpentan-1-ol |
|---|---|
| PubChem CID | 101464213 |
| Molecular Formula | C29H29NO |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (2S)-4-methyl-2-(naphthalen-1-ylmethylideneamino)-1,1-diphenylpentan-1-ol |
| SMILES | CC(C)C[C@H](/N=C/c1cccc2ccccc12)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO/c1-22(2)20-28(30-21-24-14-11-13-23-12-9-10-19-27(23)24)29(31,25-15-5-3-6-16-25)26-17-7-4-8-18-26/h3-19,21-22,28,31H,20H2,1-2H3/b30-21+/t28-/m0/s1 |
| InChIKey | AHNJWEJAJQNVCW-PYRNPVBESA-N |
| XLogP | 6.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|