C40H34NOP — CID 24882028
(2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,1,3-triphenylpropan-1-ol (PubChem CID 24882028) has the molecular formula C40H34NOP and a molecular weight of 575.69 g/mol. Its IUPAC name is (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,1,3-triphenylpropan-1-ol.
| Compound Name | (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,1,3-triphenylpropan-1-ol |
|---|---|
| PubChem CID | 24882028 |
| Molecular Formula | C40H34NOP |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,1,3-triphenylpropan-1-ol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@H](Cc1ccccc1)/N=C\c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H34NOP/c42-40(34-21-8-2-9-22-34,35-23-10-3-11-24-35)39(30-32-18-6-1-7-19-32)41-31-33-20-16-17-29-38(33)43(36-25-12-4-13-26-36)37-27-14-5-15-28-37/h1-29,31,39,42H,30H2/b41-31-/t39-/m0/s1 |
| InChIKey | JTXBJKNRYWKBDE-VTOXNATKSA-N |
| XLogP | 7.41 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|