C52H42N2P2 — CID 59365608
1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,2-diphenylethyl]methanimine (PubChem CID 59365608) has the molecular formula C52H42N2P2 and a molecular weight of 756.87 g/mol. Its IUPAC name is 1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,2-diphenylethyl]methanimine.
| Compound Name | 1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,2-diphenylethyl]methanimine |
|---|---|
| PubChem CID | 59365608 |
| Molecular Formula | C52H42N2P2 |
| Molecular Weight | 756.87 g/mol |
| Exact Mass | 756.28 |
| IUPAC Name | 1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-1,2-diphenylethyl]methanimine |
| SMILES | C(=N\C(c1ccccc1)[C@H](/N=C\c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1)\c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H42N2P2/c1-7-23-41(24-8-1)51(53-39-43-27-19-21-37-49(43)55(45-29-11-3-12-30-45)46-31-13-4-14-32-46)52(42-25-9-2-10-26-42)54-40-44-28-20-22-38-50(44)56(47-33-15-5-16-34-47)48-35-17-6-18-36-48/h1-40,51-52H/b53-39-,54-40-/t51-,52?/m1/s1 |
| InChIKey | FRCUVFCGVKRGDL-TZOZHZJTSA-N |
| XLogP | 10.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.87 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|