C41H36N2P2 — CID 101057932
1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]propyl]methanimine (PubChem CID 101057932) has the molecular formula C41H36N2P2 and a molecular weight of 618.70 g/mol. Its IUPAC name is 1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]propyl]methanimine.
| Compound Name | 1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]propyl]methanimine |
|---|---|
| PubChem CID | 101057932 |
| Molecular Formula | C41H36N2P2 |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 1-(2-diphenylphosphanylphenyl)-N-[(2R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]propyl]methanimine |
| SMILES | C[C@H](C/N=C/c1ccccc1P(c1ccccc1)c1ccccc1)/N=C\c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H36N2P2/c1-33(43-32-35-19-15-17-29-41(35)45(38-24-10-4-11-25-38)39-26-12-5-13-27-39)30-42-31-34-18-14-16-28-40(34)44(36-20-6-2-7-21-36)37-22-8-3-9-23-37/h2-29,31-33H,30H2,1H3/b42-31+,43-32-/t33-/m1/s1 |
| InChIKey | IVYOYEAKWVQSBS-VYTPUOMJSA-N |
| XLogP | 7.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|