C32H33N2O2P — CID 134991202
(2S,3R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-N-(4-methoxyphenyl)-3-methylpentanamide (PubChem CID 134991202) has the molecular formula C32H33N2O2P and a molecular weight of 508.60 g/mol. Its IUPAC name is (2S,3R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-N-(4-methoxyphenyl)-3-methylpentanamide.
| Compound Name | (2S,3R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-N-(4-methoxyphenyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 134991202 |
| Molecular Formula | C32H33N2O2P |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (2S,3R)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-N-(4-methoxyphenyl)-3-methylpentanamide |
| SMILES | CC[C@@H](C)[C@H](N=Cc1ccccc1P(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C32H33N2O2P/c1-4-24(2)31(32(35)34-26-19-21-27(36-3)22-20-26)33-23-25-13-11-12-18-30(25)37(28-14-7-5-8-15-28)29-16-9-6-10-17-29/h5-24,31H,4H2,1-3H3,(H,34,35)/t24-,31+/m1/s1 |
| InChIKey | GERKJHSOZARUKE-XJFCNFDWSA-N |
| XLogP | 5.93 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|