C25H25CsNO2P — CID 154726111
cesium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate (PubChem CID 154726111) has the molecular formula C25H25CsNO2P and a molecular weight of 535.36 g/mol. Its IUPAC name is cesium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate.
| Compound Name | cesium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 154726111 |
| Molecular Formula | C25H25CsNO2P |
| Molecular Weight | 535.36 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | cesium (2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](/N=C/c1ccccc1P(c1ccccc1)c1ccccc1)C(=O)[O-].[Cs+] |
| InChI | InChI=1S/C25H26NO2P.Cs/c1-25(2,3)23(24(27)28)26-18-19-12-10-11-17-22(19)29(20-13-6-4-7-14-20)21-15-8-5-9-16-21;/h4-18,23H,1-3H3,(H,27,28);/q;+1/p-1/b26-18+;/t23-;/m1./s1 |
| InChIKey | AWVFBUWFVUNDRO-CCNYVGMNSA-M |
| XLogP | 0.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|