C28H25N2O3PPd — CID 135466979
acetic acid;(NE,Z)-N-[(2-diphenylphosphanylphenyl)methylidene]benzenecarbohydrazonic acid;palladium (PubChem CID 135466979) has the molecular formula C28H25N2O3PPd and a molecular weight of 574.91 g/mol. Its IUPAC name is acetic acid;(NE,Z)-N-[(2-diphenylphosphanylphenyl)methylidene]benzenecarbohydrazonic acid;palladium.
| Compound Name | acetic acid;(NE,Z)-N-[(2-diphenylphosphanylphenyl)methylidene]benzenecarbohydrazonic acid;palladium |
|---|---|
| PubChem CID | 135466979 |
| Molecular Formula | C28H25N2O3PPd |
| Molecular Weight | 574.91 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | acetic acid;(NE,Z)-N-[(2-diphenylphosphanylphenyl)methylidene]benzenecarbohydrazonic acid;palladium |
| SMILES | CC(=O)O.O/C(=N\N=C\c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1.[Pd] |
| InChI | InChI=1S/C26H21N2OP.C2H4O2.Pd/c29-26(21-12-4-1-5-13-21)28-27-20-22-14-10-11-19-25(22)30(23-15-6-2-7-16-23)24-17-8-3-9-18-24;1-2(3)4;/h1-20H,(H,28,29);1H3,(H,3,4);/b27-20+;; |
| InChIKey | SSUBYPMZQHWADG-XEBZZKOLSA-N |
| XLogP | 4.87 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|