C17H14Cl4N2 — CID 2835360
1-(2,4-dichlorophenyl)-N-[2-[(2,4-dichlorophenyl)methylideneamino]propyl]methanimine (PubChem CID 2835360) has the molecular formula C17H14Cl4N2 and a molecular weight of 388.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[2-[(2,4-dichlorophenyl)methylideneamino]propyl]methanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[2-[(2,4-dichlorophenyl)methylideneamino]propyl]methanimine |
|---|---|
| PubChem CID | 2835360 |
| Molecular Formula | C17H14Cl4N2 |
| Molecular Weight | 388.13 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[2-[(2,4-dichlorophenyl)methylideneamino]propyl]methanimine |
| SMILES | CC(C/N=C/c1ccc(Cl)cc1Cl)/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl4N2/c1-11(23-10-13-3-5-15(19)7-17(13)21)8-22-9-12-2-4-14(18)6-16(12)20/h2-7,9-11H,8H2,1H3/b22-9+,23-10+ |
| InChIKey | WGVBSKXYHZCOIF-HHAMRVRLSA-N |
| XLogP | 6.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.13 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|