C16H14Cl3N — CID 14599842
N-[2-(3-chloro-2-methylphenyl)ethyl]-1-(2,4-dichlorophenyl)methanimine (PubChem CID 14599842) has the molecular formula C16H14Cl3N and a molecular weight of 326.65 g/mol. Its IUPAC name is N-[2-(3-chloro-2-methylphenyl)ethyl]-1-(2,4-dichlorophenyl)methanimine.
| Compound Name | N-[2-(3-chloro-2-methylphenyl)ethyl]-1-(2,4-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 14599842 |
| Molecular Formula | C16H14Cl3N |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-[2-(3-chloro-2-methylphenyl)ethyl]-1-(2,4-dichlorophenyl)methanimine |
| SMILES | Cc1c(Cl)cccc1CC/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl3N/c1-11-12(3-2-4-15(11)18)7-8-20-10-13-5-6-14(17)9-16(13)19/h2-6,9-10H,7-8H2,1H3/b20-10+ |
| InChIKey | AQGMMXLCELZQIT-KEBDBYFISA-N |
| XLogP | 5.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|