C16H11Cl3N4S — CID 6900289
2-[(2-chlorophenyl)methyl]-4-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3-thione (PubChem CID 6900289) has the molecular formula C16H11Cl3N4S and a molecular weight of 397.72 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-4-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2-chlorophenyl)methyl]-4-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 6900289 |
| Molecular Formula | C16H11Cl3N4S |
| Molecular Weight | 397.72 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-4-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3-thione |
| SMILES | S=c1n(/N=C/c2ccc(Cl)cc2Cl)cnn1Cc1ccccc1Cl |
| InChI | InChI=1S/C16H11Cl3N4S/c17-13-6-5-11(15(19)7-13)8-20-23-10-21-22(16(23)24)9-12-3-1-2-4-14(12)18/h1-8,10H,9H2/b20-8+ |
| InChIKey | JHJDGNPZRJADES-DNTJNYDQSA-N |
| XLogP | 5.30 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|