C16H12Cl2N4OS — CID 7728552
4-[(Z)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 7728552) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is 4-[(Z)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 7728552 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 4-[(Z)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1/N=C\c1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl2N4OS/c17-13-6-5-12(14(18)7-13)9-23-15-4-2-1-3-11(15)8-20-22-10-19-21-16(22)24/h1-8,10H,9H2,(H,21,24)/b20-8- |
| InChIKey | KROHCOVAELBJGV-ZBKNUEDVSA-N |
| XLogP | 4.71 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|