C14H11ClN4O2S — CID 51851382
4-[(Z)-[5-[(2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 51851382) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 4-[(Z)-[5-[(2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[5-[(2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 51851382 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-[(Z)-[5-[(2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1/N=C\c1ccc(COc2ccccc2Cl)o1 |
| InChI | InChI=1S/C14H11ClN4O2S/c15-12-3-1-2-4-13(12)20-8-11-6-5-10(21-11)7-17-19-9-16-18-14(19)22/h1-7,9H,8H2,(H,18,22)/b17-7- |
| InChIKey | CVBXBYKFMMNWBZ-IDUWFGFVSA-N |
| XLogP | 3.65 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|