C18H12Cl2N4O3S — CID 19588959
4-[(E)-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 19588959) has the molecular formula C18H12Cl2N4O3S and a molecular weight of 435.29 g/mol. Its IUPAC name is 4-[(E)-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 19588959 |
| Molecular Formula | C18H12Cl2N4O3S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 4-[(E)-[5-[(2,3-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccco2)n1/N=C/c1ccc(COc2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C18H12Cl2N4O3S/c19-13-3-1-4-14(16(13)20)26-10-12-7-6-11(27-12)9-21-24-17(22-23-18(24)28)15-5-2-8-25-15/h1-9H,10H2,(H,23,28)/b21-9+ |
| InChIKey | QNBGBMPQDRWLHJ-ZVBGSRNCSA-N |
| XLogP | 5.56 |
| TPSA | 81.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|