C16H14Cl2N4O2S — CID 110520890
4-[(Z)-(3,5-dichloro-4-propoxyphenyl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 110520890) has the molecular formula C16H14Cl2N4O2S and a molecular weight of 397.29 g/mol. Its IUPAC name is 4-[(Z)-(3,5-dichloro-4-propoxyphenyl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3,5-dichloro-4-propoxyphenyl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520890 |
| Molecular Formula | C16H14Cl2N4O2S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 4-[(Z)-(3,5-dichloro-4-propoxyphenyl)methylideneamino]-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCOc1c(Cl)cc(/C=N\n2c(-c3ccco3)n[nH]c2=S)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N4O2S/c1-2-5-24-14-11(17)7-10(8-12(14)18)9-19-22-15(20-21-16(22)25)13-4-3-6-23-13/h3-4,6-9H,2,5H2,1H3,(H,21,25)/b19-9- |
| InChIKey | QMFYOIOOCFOGBU-OCKHKDLRSA-N |
| XLogP | 5.18 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|