C19H21ClN4O2S2 — CID 110521129
4-[(Z)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 110521129) has the molecular formula C19H21ClN4O2S2 and a molecular weight of 436.99 g/mol. Its IUPAC name is 4-[(Z)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110521129 |
| Molecular Formula | C19H21ClN4O2S2 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 4-[(Z)-(3-chloro-5-ethoxy-4-propoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCOc1c(Cl)cc(/C=N\n2c(Cc3cccs3)n[nH]c2=S)cc1OCC |
| InChI | InChI=1S/C19H21ClN4O2S2/c1-3-7-26-18-15(20)9-13(10-16(18)25-4-2)12-21-24-17(22-23-19(24)27)11-14-6-5-8-28-14/h5-6,8-10,12H,3-4,7,11H2,1-2H3,(H,23,27)/b21-12- |
| InChIKey | GJXXFCDRBUNBGS-MTJSOVHGSA-N |
| XLogP | 5.32 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|