C21H26N4O2S2 — CID 110521126
4-[(Z)-(3-ethoxy-4-pentoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 110521126) has the molecular formula C21H26N4O2S2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-[(Z)-(3-ethoxy-4-pentoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3-ethoxy-4-pentoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110521126 |
| Molecular Formula | C21H26N4O2S2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-[(Z)-(3-ethoxy-4-pentoxyphenyl)methylideneamino]-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCCOc1ccc(/C=N\n2c(Cc3cccs3)n[nH]c2=S)cc1OCC |
| InChI | InChI=1S/C21H26N4O2S2/c1-3-5-6-11-27-18-10-9-16(13-19(18)26-4-2)15-22-25-20(23-24-21(25)28)14-17-8-7-12-29-17/h7-10,12-13,15H,3-6,11,14H2,1-2H3,(H,24,28)/b22-15- |
| InChIKey | LXMYXCPKUXDIHY-JCMHNJIXSA-N |
| XLogP | 5.44 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|