C23H36N4O2S — CID 110519300
4-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-3-propan-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 110519300) has the molecular formula C23H36N4O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is 4-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-3-propan-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-3-propan-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110519300 |
| Molecular Formula | C23H36N4O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 4-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-3-propan-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCCCCCCOc1ccc(/C=N\n2c(C(C)C)n[nH]c2=S)cc1OCC |
| InChI | InChI=1S/C23H36N4O2S/c1-5-7-8-9-10-11-12-15-29-20-14-13-19(16-21(20)28-6-2)17-24-27-22(18(3)4)25-26-23(27)30/h13-14,16-18H,5-12,15H2,1-4H3,(H,26,30)/b24-17- |
| InChIKey | MOMWMHAMVCHQAW-ULJHMMPZSA-N |
| XLogP | 6.47 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|