C14H10Cl2N4O2S — CID 19588887
4-[(E)-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 19588887) has the molecular formula C14H10Cl2N4O2S and a molecular weight of 369.23 g/mol. Its IUPAC name is 4-[(E)-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 19588887 |
| Molecular Formula | C14H10Cl2N4O2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 4-[(E)-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1/N=C/c1ccc(COc2c(Cl)cccc2Cl)o1 |
| InChI | InChI=1S/C14H10Cl2N4O2S/c15-11-2-1-3-12(16)13(11)21-7-10-5-4-9(22-10)6-18-20-8-17-19-14(20)23/h1-6,8H,7H2,(H,19,23)/b18-6+ |
| InChIKey | XPTNMDIBBFVXFC-NGYBGAFCSA-N |
| XLogP | 4.30 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|