C14H9BrCl2N2 — CID 6156927
(Z)-N-[(Z)-(2-bromophenyl)methylideneamino]-1-(2,4-dichlorophenyl)methanimine (PubChem CID 6156927) has the molecular formula C14H9BrCl2N2 and a molecular weight of 356.05 g/mol. Its IUPAC name is (Z)-N-[(Z)-(2-bromophenyl)methylideneamino]-1-(2,4-dichlorophenyl)methanimine.
| Compound Name | (Z)-N-[(Z)-(2-bromophenyl)methylideneamino]-1-(2,4-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 6156927 |
| Molecular Formula | C14H9BrCl2N2 |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | (Z)-N-[(Z)-(2-bromophenyl)methylideneamino]-1-(2,4-dichlorophenyl)methanimine |
| SMILES | Clc1ccc(/C=N\N=C/c2ccccc2Br)c(Cl)c1 |
| InChI | InChI=1S/C14H9BrCl2N2/c15-13-4-2-1-3-10(13)8-18-19-9-11-5-6-12(16)7-14(11)17/h1-9H/b18-8-,19-9- |
| InChIKey | AZXSAFDCRAONNV-LVTUVZGMSA-N |
| XLogP | 5.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|