C18H15ClN4O2S — CID 6900288
methyl 4-[(E)-[1-[(2-chlorophenyl)methyl]-5-sulfanylidene-1,2,4-triazol-4-yl]iminomethyl]benzoate (PubChem CID 6900288) has the molecular formula C18H15ClN4O2S and a molecular weight of 386.86 g/mol. Its IUPAC name is methyl 4-[(E)-[1-[(2-chlorophenyl)methyl]-5-sulfanylidene-1,2,4-triazol-4-yl]iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-[1-[(2-chlorophenyl)methyl]-5-sulfanylidene-1,2,4-triazol-4-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 6900288 |
| Molecular Formula | C18H15ClN4O2S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | methyl 4-[(E)-[1-[(2-chlorophenyl)methyl]-5-sulfanylidene-1,2,4-triazol-4-yl]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/n2cnn(Cc3ccccc3Cl)c2=S)cc1 |
| InChI | InChI=1S/C18H15ClN4O2S/c1-25-17(24)14-8-6-13(7-9-14)10-20-23-12-21-22(18(23)26)11-15-4-2-3-5-16(15)19/h2-10,12H,11H2,1H3/b20-10+ |
| InChIKey | PURVTNFDRQGDLL-KEBDBYFISA-N |
| XLogP | 3.78 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|