C23H20ClN3O5 — CID 42055497
methyl 4-[(E)-3-[2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 42055497) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is methyl 4-[(E)-3-[2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 42055497 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | methyl 4-[(E)-3-[2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)OCC(=O)Nc2ccnn2Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O5/c1-31-23(30)17-9-6-16(7-10-17)8-11-22(29)32-15-21(28)26-20-12-13-25-27(20)14-18-4-2-3-5-19(18)24/h2-13H,14-15H2,1H3,(H,26,28)/b11-8+ |
| InChIKey | NBKKMQSCFIGQSJ-DHZHZOJOSA-N |
| XLogP | 3.57 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|