C23H19ClN4O5 — CID 55468124
[2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55468124) has the molecular formula C23H19ClN4O5 and a molecular weight of 466.88 g/mol. Its IUPAC name is [2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55468124 |
| Molecular Formula | C23H19ClN4O5 |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [2-[[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCC(=O)Nc1ccnn1Cc1ccccc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H19ClN4O5/c1-14(28-21(30)16-7-3-4-8-17(16)22(28)31)23(32)33-13-20(29)26-19-10-11-25-27(19)12-15-6-2-5-9-18(15)24/h2-11,14H,12-13H2,1H3,(H,26,29) |
| InChIKey | AVYFZELFJGBECD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|