C19H19ClN4O2S — CID 60579255
methyl 2-[(2-chlorophenyl)methyl-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]acetate (PubChem CID 60579255) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is methyl 2-[(2-chlorophenyl)methyl-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]acetate.
| Compound Name | methyl 2-[(2-chlorophenyl)methyl-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]acetate |
|---|---|
| PubChem CID | 60579255 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | methyl 2-[(2-chlorophenyl)methyl-[(4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1ccccc1Cl)Cn1ncn(-c2ccccc2)c1=S |
| InChI | InChI=1S/C19H19ClN4O2S/c1-26-18(25)12-22(11-15-7-5-6-10-17(15)20)14-24-19(27)23(13-21-24)16-8-3-2-4-9-16/h2-10,13H,11-12,14H2,1H3 |
| InChIKey | ZYXZXWJCIHGWHJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|