C13H19ClN2O2 — CID 102662972
methyl 2-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]acetate (PubChem CID 102662972) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is methyl 2-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]acetate.
| Compound Name | methyl 2-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]acetate |
|---|---|
| PubChem CID | 102662972 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | methyl 2-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]acetate |
| SMILES | CCN(CC(=O)OC)Cc1ccc(CN)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O2/c1-3-16(9-13(17)18-2)8-11-5-4-10(7-15)6-12(11)14/h4-6H,3,7-9,15H2,1-2H3 |
| InChIKey | YDAILAQPIMYEJY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |