C14H23ClN2O — CID 102663034
1-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]-2-methylpropan-2-ol (PubChem CID 102663034) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 102663034 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[[4-(aminomethyl)-2-chlorophenyl]methyl-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(Cc1ccc(CN)cc1Cl)CC(C)(C)O |
| InChI | InChI=1S/C14H23ClN2O/c1-4-17(10-14(2,3)18)9-12-6-5-11(8-16)7-13(12)15/h5-7,18H,4,8-10,16H2,1-3H3 |
| InChIKey | XMQKQODAWZGKLX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |