C16H16Cl2N4 — CID 5402226
(Z)-1-(2,4-dichlorophenyl)-N-(4-pyridin-2-ylpiperazin-1-yl)methanimine (PubChem CID 5402226) has the molecular formula C16H16Cl2N4 and a molecular weight of 335.24 g/mol. Its IUPAC name is (Z)-1-(2,4-dichlorophenyl)-N-(4-pyridin-2-ylpiperazin-1-yl)methanimine.
| Compound Name | (Z)-1-(2,4-dichlorophenyl)-N-(4-pyridin-2-ylpiperazin-1-yl)methanimine |
|---|---|
| PubChem CID | 5402226 |
| Molecular Formula | C16H16Cl2N4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (Z)-1-(2,4-dichlorophenyl)-N-(4-pyridin-2-ylpiperazin-1-yl)methanimine |
| SMILES | Clc1ccc(/C=N\N2CCN(c3ccccn3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N4/c17-14-5-4-13(15(18)11-14)12-20-22-9-7-21(8-10-22)16-3-1-2-6-19-16/h1-6,11-12H,7-10H2/b20-12- |
| InChIKey | WONJEZJYSWIFPJ-NDENLUEZSA-N |
| XLogP | 3.54 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|