C24H34N4O — CID 135609546
2,6-ditert-butyl-4-[(E)-(4-pyridin-2-ylpiperazin-1-yl)iminomethyl]phenol (PubChem CID 135609546) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(E)-(4-pyridin-2-ylpiperazin-1-yl)iminomethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(E)-(4-pyridin-2-ylpiperazin-1-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135609546 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(E)-(4-pyridin-2-ylpiperazin-1-yl)iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/N2CCN(c3ccccn3)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H34N4O/c1-23(2,3)19-15-18(16-20(22(19)29)24(4,5)6)17-26-28-13-11-27(12-14-28)21-9-7-8-10-25-21/h7-10,15-17,29H,11-14H2,1-6H3/b26-17+ |
| InChIKey | WFONEDKIQPFLDD-YZSQISJMSA-N |
| XLogP | 4.54 |
| TPSA | 51.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|