C32H44N4O — CID 28720978
2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methyl]phenol (PubChem CID 28720978) has the molecular formula C32H44N4O and a molecular weight of 500.73 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 28720978 |
| Molecular Formula | C32H44N4O |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methyl]phenol |
| SMILES | CN(C)c1ccc([C@H](c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C32H44N4O/c1-31(2,3)26-21-24(22-27(30(26)37)32(4,5)6)29(23-12-14-25(15-13-23)34(7)8)36-19-17-35(18-20-36)28-11-9-10-16-33-28/h9-16,21-22,29,37H,17-20H2,1-8H3/t29-/m1/s1 |
| InChIKey | QJUUPWYDHZUNDY-GDLZYMKVSA-N |
| XLogP | 6.36 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|