C25H37N3O — CID 155563652
2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)-pyridin-2-ylmethyl]phenol (PubChem CID 155563652) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)-pyridin-2-ylmethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)-pyridin-2-ylmethyl]phenol |
|---|---|
| PubChem CID | 155563652 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 2,6-ditert-butyl-4-[(4-methylpiperazin-1-yl)-pyridin-2-ylmethyl]phenol |
| SMILES | CN1CCN(C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2ccccn2)CC1 |
| InChI | InChI=1S/C25H37N3O/c1-24(2,3)19-16-18(17-20(23(19)29)25(4,5)6)22(21-10-8-9-11-26-21)28-14-12-27(7)13-15-28/h8-11,16-17,22,29H,12-15H2,1-7H3 |
| InChIKey | NXYAUMBWXZECSU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |