C27H32N4O — CID 135722741
N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridine-2-carboximidamide (PubChem CID 135722741) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridine-2-carboximidamide.
| Compound Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 135722741 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridine-2-carboximidamide |
| SMILES | CC(C)(C)c1cc(/C=N/N/C(=N/c2ccccc2)c2ccccn2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H32N4O/c1-26(2,3)21-16-19(17-22(24(21)32)27(4,5)6)18-29-31-25(23-14-10-11-15-28-23)30-20-12-8-7-9-13-20/h7-18,32H,1-6H3,(H,30,31)/b29-18+ |
| InChIKey | MCQMZBZOQRAQSD-RDRPBHBLSA-N |
| XLogP | 6.08 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|