C27H33N4O+ — CID 135422495
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide (PubChem CID 135422495) has the molecular formula C27H33N4O+ and a molecular weight of 429.59 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide |
|---|---|
| PubChem CID | 135422495 |
| Molecular Formula | C27H33N4O+ |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide |
| SMILES | CC(C)(C)c1cc(C=NN/C(=N/c2ccccc2)c2cccc[nH+]2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H32N4O/c1-26(2,3)21-16-19(17-22(24(21)32)27(4,5)6)18-29-31-25(23-14-10-11-15-28-23)30-20-12-8-7-9-13-20/h7-18,32H,1-6H3,(H,30,31)/p+1 |
| InChIKey | MCQMZBZOQRAQSD-UHFFFAOYSA-O |
| XLogP | 5.50 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|