C19H15Cl2N4+ — CID 135478497
N-[(2,4-dichlorophenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide (PubChem CID 135478497) has the molecular formula C19H15Cl2N4+ and a molecular weight of 370.26 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide |
|---|---|
| PubChem CID | 135478497 |
| Molecular Formula | C19H15Cl2N4+ |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-N'-phenylpyridin-1-ium-2-carboximidamide |
| SMILES | Clc1ccc(C=NN/C(=N/c2ccccc2)c2cccc[nH+]2)c(Cl)c1 |
| InChI | InChI=1S/C19H14Cl2N4/c20-15-10-9-14(17(21)12-15)13-23-25-19(18-8-4-5-11-22-18)24-16-6-2-1-3-7-16/h1-13H,(H,24,25)/p+1 |
| InChIKey | HMNFZOLNAVJCNT-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|